C26H28F3N7O7 — CID 136950037
5-O-butyl 1-O-methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate (PubChem CID 136950037) has the molecular formula C26H28F3N7O7 and a molecular weight of 607.55 g/mol. Its IUPAC name is 5-O-butyl 1-O-methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | 5-O-butyl 1-O-methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 136950037 |
| Molecular Formula | C26H28F3N7O7 |
| Molecular Weight | 607.55 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 5-O-butyl 1-O-methyl (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
| SMILES | CCCCOC(=O)CC[C@H](NC(=O)c1ccc(N(Cc2cnc3nc(N)[nH]c(=O)c3n2)C(=O)C(F)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C26H28F3N7O7/c1-3-4-11-43-18(37)10-9-17(23(40)42-2)33-21(38)14-5-7-16(8-6-14)36(24(41)26(27,28)29)13-15-12-31-20-19(32-15)22(39)35-25(30)34-20/h5-8,12,17H,3-4,9-11,13H2,1-2H3,(H,33,38)(H3,30,31,34,35,39)/t17-/m0/s1 |
| InChIKey | AZKCJAHDQRSDIL-KRWDZBQOSA-N |
| XLogP | 1.79 |
| TPSA | 199.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|