C24H24FN5O2 — CID 136950074
(Z)-3-[5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1H-imidazol-2-yl]-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-imine (PubChem CID 136950074) has the molecular formula C24H24FN5O2 and a molecular weight of 433.49 g/mol. Its IUPAC name is (Z)-3-[5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1H-imidazol-2-yl]-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-imine.
| Compound Name | (Z)-3-[5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1H-imidazol-2-yl]-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 136950074 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (Z)-3-[5-[6-(1,3-dioxolan-2-yl)-2-pyridinyl]-1H-imidazol-2-yl]-1-[2-(3-fluorophenyl)pyrrolidin-1-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C\c1ncc(-c2cccc(C3OCCO3)n2)[nH]1)N1CCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C24H24FN5O2/c25-17-5-1-4-16(14-17)21-8-3-11-30(21)22(26)9-10-23-27-15-20(29-23)18-6-2-7-19(28-18)24-31-12-13-32-24/h1-2,4-7,9-10,14-15,21,24,26H,3,8,11-13H2,(H,27,29)/b10-9-,26-22- |
| InChIKey | WOOZIWMBTKIKOW-TXVBKZQUSA-N |
| XLogP | 4.48 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|