C15H15ClN4O2S — CID 136950385
ethyl 2-[(2E)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate chloride (PubChem CID 136950385) has the molecular formula C15H15ClN4O2S and a molecular weight of 350.83 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate chloride.
| Compound Name | ethyl 2-[(2E)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate chloride |
|---|---|
| PubChem CID | 136950385 |
| Molecular Formula | C15H15ClN4O2S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | ethyl 2-[(2E)-2-[(4-cyanophenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-3-ium-5-carboxylate chloride |
| SMILES | CCOC(=O)c1sc(N/N=C/c2ccc(C#N)cc2)[nH+]c1C.[Cl-] |
| InChI | InChI=1S/C15H14N4O2S.ClH/c1-3-21-14(20)13-10(2)18-15(22-13)19-17-9-12-6-4-11(8-16)5-7-12;/h4-7,9H,3H2,1-2H3,(H,18,19);1H/b17-9+; |
| InChIKey | UNLVQNQUXUDQQS-WWIHJBQESA-N |
| XLogP | -0.63 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|