C14H14N4O3S — CID 136950392
1-methyl-3-(4-methylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 136950392) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 1-methyl-3-(4-methylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 1-methyl-3-(4-methylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 136950392 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-methyl-3-(4-methylsulfonylanilino)-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | Cn1nc(Nc2ccc(S(C)(=O)=O)cc2)c2c(=O)[nH]ccc21 |
| InChI | InChI=1S/C14H14N4O3S/c1-18-11-7-8-15-14(19)12(11)13(17-18)16-9-3-5-10(6-4-9)22(2,20)21/h3-8H,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | RWYNQKHEKPVBJB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |