C23H23F3N6O2 — CID 136950512
(3R,4S)-3-[3-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]anilino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]oxane-4-carbonitrile (PubChem CID 136950512) has the molecular formula C23H23F3N6O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is (3R,4S)-3-[3-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]anilino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]oxane-4-carbonitrile.
| Compound Name | (3R,4S)-3-[3-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]anilino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 136950512 |
| Molecular Formula | C23H23F3N6O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (3R,4S)-3-[3-[4-[1-(cyclopropylamino)-2,2,2-trifluoroethyl]anilino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]oxane-4-carbonitrile |
| SMILES | N#C[C@H]1CCOC[C@@H]1n1nc(Nc2ccc(C(NC3CC3)C(F)(F)F)cc2)c2c(=O)[nH]ccc21 |
| InChI | InChI=1S/C23H23F3N6O2/c24-23(25,26)20(29-15-5-6-15)13-1-3-16(4-2-13)30-21-19-17(7-9-28-22(19)33)32(31-21)18-12-34-10-8-14(18)11-27/h1-4,7,9,14-15,18,20,29H,5-6,8,10,12H2,(H,28,33)(H,30,31)/t14-,18+,20?/m1/s1 |
| InChIKey | UVJKFXUPMZJTBX-KJOMBKDJSA-N |
| XLogP | 3.92 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |