C12H23N3O2S — CID 136951342
2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 136951342) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 136951342 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCC1(CC)CS/C(=N\CC(=O)NCCOC)N1 |
| InChI | InChI=1S/C12H23N3O2S/c1-4-12(5-2)9-18-11(15-12)14-8-10(16)13-6-7-17-3/h4-9H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | AXXCSBQZJCIJPL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|