About 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide
2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 136951342) has the molecular formula C12H23N3O2S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide |
| PubChem CID | 136951342 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCC1(CC)CS/C(=N\CC(=O)NCCOC)N1 |
| InChI | InChI=1S/C12H23N3O2S/c1-4-12(5-2)9-18-11(15-12)14-8-10(16)13-6-7-17-3/h4-9H2,1-3H3,(H,13,16)(H,14,15) |
| InChIKey | AXXCSBQZJCIJPL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide (CID 136951342) is 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide is CCC1(CC)CS/C(=N\CC(=O)NCCOC)N1.
What is the InChIKey of 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide?
The InChIKey is AXXCSBQZJCIJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2S/c1-4-12(5-2)9-18-11(15-12)14-8-10(16)13-6-7-17-3/h4-9H2,1-3H3,(H,13,16)(H,14,15).
What are the key properties of 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide?
2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide has a molecular weight of 273.40 g/mol, XLogP of 1.00, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-diethyl-1,3-thiazolidin-2-ylidene)amino]-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 136951342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).