C10H16N4O3 — CID 136951350
2-[(4,5-dioxoimidazolidin-2-ylidene)amino]-N-(2-methylpropyl)propanamide (PubChem CID 136951350) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[(4,5-dioxoimidazolidin-2-ylidene)amino]-N-(2-methylpropyl)propanamide.
| Compound Name | 2-[(4,5-dioxoimidazolidin-2-ylidene)amino]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 136951350 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-[(4,5-dioxoimidazolidin-2-ylidene)amino]-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)C(C)N=C1NC(=O)C(=O)N1 |
| InChI | InChI=1S/C10H16N4O3/c1-5(2)4-11-7(15)6(3)12-10-13-8(16)9(17)14-10/h5-6H,4H2,1-3H3,(H,11,15)(H2,12,13,14,16,17) |
| InChIKey | SRINGLVPIMDPGO-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|