About N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine
N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine (PubChem CID 136951415) has the molecular formula C6H5N3OS
and a molecular weight of 167.19 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine |
| PubChem CID | 136951415 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine |
| SMILES | ONc1ccc2nsnc2c1 |
| InChI | InChI=1S/C6H5N3OS/c10-7-4-1-2-5-6(3-4)9-11-8-5/h1-3,7,10H |
| InChIKey | XTYPNNDJNIOLFS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine?
The IUPAC name of N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine (CID 136951415) is N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine.
What is the SMILES notation for N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine?
The canonical SMILES for N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine is ONc1ccc2nsnc2c1.
What is the InChIKey of N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine?
The InChIKey is XTYPNNDJNIOLFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3OS/c10-7-4-1-2-5-6(3-4)9-11-8-5/h1-3,7,10H.
What are the key properties of N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine?
N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine has a molecular weight of 167.19 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,1,3-benzothiadiazol-5-yl)hydroxylamine is sourced from PubChem (CID 136951415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).