About 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one
6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one (PubChem CID 136951526) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one.
Molecular Properties
| Compound Name | 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one |
| PubChem CID | 136951526 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one |
| SMILES | Cc1cc(=O)c2cn[nH]c2[nH]1 |
| InChI | InChI=1S/C7H7N3O/c1-4-2-6(11)5-3-8-10-7(5)9-4/h2-3H,1H3,(H2,8,9,10,11) |
| InChIKey | UYFGTXBJLVCJGR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one?
The IUPAC name of 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one (CID 136951526) is 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one.
What is the SMILES notation for 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one?
The canonical SMILES for 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one is Cc1cc(=O)c2cn[nH]c2[nH]1.
What is the InChIKey of 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one?
The InChIKey is UYFGTXBJLVCJGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-4-2-6(11)5-3-8-10-7(5)9-4/h2-3H,1H3,(H2,8,9,10,11).
What are the key properties of 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one?
6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one has a molecular weight of 149.15 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,7-dihydropyrazolo[5,4-b]pyridin-4-one is sourced from PubChem (CID 136951526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).