C13H17N3O — CID 136951933
4,5-dimethyl-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5-trien-8-one (PubChem CID 136951933) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 4,5-dimethyl-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5-trien-8-one.
| Compound Name | 4,5-dimethyl-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 136951933 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4,5-dimethyl-2,3,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,5-trien-8-one |
| SMILES | Cc1nn2c3c(c(=O)[nH]c2c1C)CCCCC3 |
| InChI | InChI=1S/C13H17N3O/c1-8-9(2)15-16-11-7-5-3-4-6-10(11)13(17)14-12(8)16/h3-7H2,1-2H3,(H,14,17) |
| InChIKey | USFKZZQYAGHUFV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |