About 6H-pyrrolo[3,2-d][1,2]thiazole
6H-pyrrolo[3,2-d][1,2]thiazole (PubChem CID 136952691) has the molecular formula C5H4N2S
and a molecular weight of 124.17 g/mol. Its IUPAC name is 6H-pyrrolo[3,2-d][1,2]thiazole.
Molecular Properties
| Compound Name | 6H-pyrrolo[3,2-d][1,2]thiazole |
| PubChem CID | 136952691 |
| Molecular Formula | C5H4N2S |
| Molecular Weight | 124.17 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | 6H-pyrrolo[3,2-d][1,2]thiazole |
| SMILES | c1cc2cnsc2[nH]1 |
| InChI | InChI=1S/C5H4N2S/c1-2-6-5-4(1)3-7-8-5/h1-3,6H |
| InChIKey | MQZZGXREUVYTKY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6H-pyrrolo[3,2-d][1,2]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrrolo[3,2-d][1,2]thiazole?
The IUPAC name of 6H-pyrrolo[3,2-d][1,2]thiazole (CID 136952691) is 6H-pyrrolo[3,2-d][1,2]thiazole.
What is the SMILES notation for 6H-pyrrolo[3,2-d][1,2]thiazole?
The canonical SMILES for 6H-pyrrolo[3,2-d][1,2]thiazole is c1cc2cnsc2[nH]1.
What is the InChIKey of 6H-pyrrolo[3,2-d][1,2]thiazole?
The InChIKey is MQZZGXREUVYTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S/c1-2-6-5-4(1)3-7-8-5/h1-3,6H.
What are the key properties of 6H-pyrrolo[3,2-d][1,2]thiazole?
6H-pyrrolo[3,2-d][1,2]thiazole has a molecular weight of 124.17 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrrolo[3,2-d][1,2]thiazole is sourced from PubChem (CID 136952691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).