C13H20F3N3O — CID 136952774
2,4-dimethyl-5-[1-(5,5,5-trifluoropentylamino)ethyl]-1H-pyrimidin-6-one (PubChem CID 136952774) has the molecular formula C13H20F3N3O and a molecular weight of 291.32 g/mol. Its IUPAC name is 2,4-dimethyl-5-[1-(5,5,5-trifluoropentylamino)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 2,4-dimethyl-5-[1-(5,5,5-trifluoropentylamino)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136952774 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2,4-dimethyl-5-[1-(5,5,5-trifluoropentylamino)ethyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(C(C)NCCCCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C13H20F3N3O/c1-8(17-7-5-4-6-13(14,15)16)11-9(2)18-10(3)19-12(11)20/h8,17H,4-7H2,1-3H3,(H,18,19,20) |
| InChIKey | MXBUUHAUQXQUBL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|