C10H17F3N2S — CID 136952797
4,4-dimethyl-N-(5,5,5-trifluoropentyl)-1,3-thiazolidin-2-imine (PubChem CID 136952797) has the molecular formula C10H17F3N2S and a molecular weight of 254.32 g/mol. Its IUPAC name is 4,4-dimethyl-N-(5,5,5-trifluoropentyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4,4-dimethyl-N-(5,5,5-trifluoropentyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136952797 |
| Molecular Formula | C10H17F3N2S |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4,4-dimethyl-N-(5,5,5-trifluoropentyl)-1,3-thiazolidin-2-imine |
| SMILES | CC1(C)CS/C(=N\CCCCC(F)(F)F)N1 |
| InChI | InChI=1S/C10H17F3N2S/c1-9(2)7-16-8(15-9)14-6-4-3-5-10(11,12)13/h3-7H2,1-2H3,(H,14,15) |
| InChIKey | YMQZSCIEPOBVSK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|