About 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one
3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136952838) has the molecular formula C9H6F2N2O2
and a molecular weight of 212.16 g/mol. Its IUPAC name is 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 136952838 |
| Molecular Formula | C9H6F2N2O2 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(-c2ccc(C(F)F)cc2)no1 |
| InChI | InChI=1S/C9H6F2N2O2/c10-7(11)5-1-3-6(4-2-5)8-12-9(14)15-13-8/h1-4,7H,(H,12,13,14) |
| InChIKey | GULOJRUOMLJWQE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one (CID 136952838) is 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one is O=c1[nH]c(-c2ccc(C(F)F)cc2)no1.
What is the InChIKey of 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one?
The InChIKey is GULOJRUOMLJWQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N2O2/c10-7(11)5-1-3-6(4-2-5)8-12-9(14)15-13-8/h1-4,7H,(H,12,13,14).
What are the key properties of 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one?
3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one has a molecular weight of 212.16 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(difluoromethyl)phenyl]-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 136952838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).