C8H7ClN2O3 — CID 136952962
2-(chloromethyl)-7,8-dihydro-3H-pyrano[4,3-d]pyrimidine-4,5-dione (PubChem CID 136952962) has the molecular formula C8H7ClN2O3 and a molecular weight of 214.61 g/mol. Its IUPAC name is 2-(chloromethyl)-7,8-dihydro-3H-pyrano[4,3-d]pyrimidine-4,5-dione.
| Compound Name | 2-(chloromethyl)-7,8-dihydro-3H-pyrano[4,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 136952962 |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2-(chloromethyl)-7,8-dihydro-3H-pyrano[4,3-d]pyrimidine-4,5-dione |
| SMILES | O=C1OCCc2nc(CCl)[nH]c(=O)c21 |
| InChI | InChI=1S/C8H7ClN2O3/c9-3-5-10-4-1-2-14-8(13)6(4)7(12)11-5/h1-3H2,(H,10,11,12) |
| InChIKey | KLCKCNGSABRUMI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|