C25H28F2N5O7P — CID 136953635
2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-methylidene-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953635) has the molecular formula C25H28F2N5O7P and a molecular weight of 579.50 g/mol. Its IUPAC name is 2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-methylidene-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-methylidene-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953635 |
| Molecular Formula | C25H28F2N5O7P |
| Molecular Weight | 579.50 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 2-amino-9-[2-[[[5-(3,3-difluorocyclopentyl)-2-methylidene-1,3-dioxol-4-yl]methoxy-phenylmethoxyphosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | C=C1OC(COP(=O)(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2ccccc2)=C(C2CCC(F)(F)C2)O1 |
| InChI | InChI=1S/C25H28F2N5O7P/c1-16-38-19(21(39-16)18-7-8-25(26,27)11-18)13-37-40(34,36-12-17-5-3-2-4-6-17)15-35-10-9-32-14-29-20-22(32)30-24(28)31-23(20)33/h2-6,14,18H,1,7-13,15H2,(H3,28,30,31,33) |
| InChIKey | YXJUJZIGIZGMMU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|