C18H21ClN5O6P — CID 136953820
2-amino-9-[2-[[4-(3-chloro-4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953820) has the molecular formula C18H21ClN5O6P and a molecular weight of 469.82 g/mol. Its IUPAC name is 2-amino-9-[2-[[4-(3-chloro-4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[4-(3-chloro-4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953820 |
| Molecular Formula | C18H21ClN5O6P |
| Molecular Weight | 469.82 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-amino-9-[2-[[4-(3-chloro-4-methoxyphenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | COc1ccc(C2CCOP(=O)(COCCn3cnc4c(=O)[nH]c(N)nc43)O2)cc1Cl |
| InChI | InChI=1S/C18H21ClN5O6P/c1-27-14-3-2-11(8-12(14)19)13-4-6-29-31(26,30-13)10-28-7-5-24-9-21-15-16(24)22-18(20)23-17(15)25/h2-3,8-9,13H,4-7,10H2,1H3,(H3,20,22,23,25) |
| InChIKey | GJPUGSMLGUHIAB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|