C21H27N5O2S — CID 136954738
(4R)-4-[(1R)-1-[3-amino-5-(5-piperazin-1-yl-2-pyridinyl)-2-sulfanylphenoxy]ethyl]pyrrolidin-2-one (PubChem CID 136954738) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is (4R)-4-[(1R)-1-[3-amino-5-(5-piperazin-1-yl-2-pyridinyl)-2-sulfanylphenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[(1R)-1-[3-amino-5-(5-piperazin-1-yl-2-pyridinyl)-2-sulfanylphenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 136954738 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (4R)-4-[(1R)-1-[3-amino-5-(5-piperazin-1-yl-2-pyridinyl)-2-sulfanylphenoxy]ethyl]pyrrolidin-2-one |
| SMILES | C[C@@H](Oc1cc(-c2ccc(N3CCNCC3)cn2)cc(N)c1S)[C@H]1CNC(=O)C1 |
| InChI | InChI=1S/C21H27N5O2S/c1-13(15-10-20(27)25-11-15)28-19-9-14(8-17(22)21(19)29)18-3-2-16(12-24-18)26-6-4-23-5-7-26/h2-3,8-9,12-13,15,23,29H,4-7,10-11,22H2,1H3,(H,25,27)/t13-,15-/m1/s1 |
| InChIKey | VNPIGIYNTFGVPP-UKRRQHHQSA-N |
| XLogP | 1.93 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|