C21H15ClN4O4 — CID 136954870
(4R)-1-[(4-chlorophenyl)methyl]spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,7'-5H-[1,3]dioxolo[4,5-f]indole]-6,6'-dione (PubChem CID 136954870) has the molecular formula C21H15ClN4O4 and a molecular weight of 422.83 g/mol. Its IUPAC name is (4R)-1-[(4-chlorophenyl)methyl]spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,7'-5H-[1,3]dioxolo[4,5-f]indole]-6,6'-dione.
| Compound Name | (4R)-1-[(4-chlorophenyl)methyl]spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,7'-5H-[1,3]dioxolo[4,5-f]indole]-6,6'-dione |
|---|---|
| PubChem CID | 136954870 |
| Molecular Formula | C21H15ClN4O4 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (4R)-1-[(4-chlorophenyl)methyl]spiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,7'-5H-[1,3]dioxolo[4,5-f]indole]-6,6'-dione |
| SMILES | O=C1C[C@]2(C(=O)Nc3cc4c(cc32)OCO4)c2cnn(Cc3ccc(Cl)cc3)c2N1 |
| InChI | InChI=1S/C21H15ClN4O4/c22-12-3-1-11(2-4-12)9-26-19-14(8-23-26)21(7-18(27)25-19)13-5-16-17(30-10-29-16)6-15(13)24-20(21)28/h1-6,8H,7,9-10H2,(H,24,28)(H,25,27)/t21-/m1/s1 |
| InChIKey | LVUJCMTZMATURE-OAQYLSRUSA-N |
| XLogP | 2.89 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |