C20H30O7 — CID 136954889
(1S,2S,6R,8R,10R,11R,13R,15R)-5,6,7,7,8,9-hexahydroxy-4,8,12,12,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadec-4-en-3-one (PubChem CID 136954889) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (1S,2S,6R,8R,10R,11R,13R,15R)-5,6,7,7,8,9-hexahydroxy-4,8,12,12,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadec-4-en-3-one.
| Compound Name | (1S,2S,6R,8R,10R,11R,13R,15R)-5,6,7,7,8,9-hexahydroxy-4,8,12,12,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadec-4-en-3-one |
|---|---|
| PubChem CID | 136954889 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1S,2S,6R,8R,10R,11R,13R,15R)-5,6,7,7,8,9-hexahydroxy-4,8,12,12,15-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadec-4-en-3-one |
| SMILES | CC1=C(O)[C@]2(O)[C@@H](C1=O)[C@@H]1[C@@H](C(O)[C@@](C)(O)C2(O)O)[C@H]2[C@@H](C[C@H]1C)C2(C)C |
| InChI | InChI=1S/C20H30O7/c1-7-6-9-12(17(9,3)4)11-10(7)13-14(21)8(2)15(22)19(13,25)20(26,27)18(5,24)16(11)23/h7,9-13,16,22-27H,6H2,1-5H3/t7-,9-,10+,11-,12-,13-,16?,18-,19-/m1/s1 |
| InChIKey | IGWIQNZLPSZHAC-QQEWGCOISA-N |
| XLogP | 0.10 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|