C6H8IN3O2 — CID 136956024
4-(2-hydroxyethylamino)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136956024) has the molecular formula C6H8IN3O2 and a molecular weight of 281.05 g/mol. Its IUPAC name is 4-(2-hydroxyethylamino)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(2-hydroxyethylamino)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956024 |
| Molecular Formula | C6H8IN3O2 |
| Molecular Weight | 281.05 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 4-(2-hydroxyethylamino)-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCO)c1I |
| InChI | InChI=1S/C6H8IN3O2/c7-4-5(8-1-2-11)9-3-10-6(4)12/h3,11H,1-2H2,(H2,8,9,10,12) |
| InChIKey | OKXKCBDMABIANG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.05 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|