C10H14BrN3O2 — CID 136956099
5-bromo-4-[1-(oxolan-2-yl)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136956099) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is 5-bromo-4-[1-(oxolan-2-yl)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[1-(oxolan-2-yl)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956099 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 5-bromo-4-[1-(oxolan-2-yl)ethylamino]-1H-pyrimidin-6-one |
| SMILES | CC(Nc1nc[nH]c(=O)c1Br)C1CCCO1 |
| InChI | InChI=1S/C10H14BrN3O2/c1-6(7-3-2-4-16-7)14-9-8(11)10(15)13-5-12-9/h5-7H,2-4H2,1H3,(H2,12,13,14,15) |
| InChIKey | WEGHFJVJFWRVKP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |