About 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one
4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136956144) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136956144 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NC2CCS(=O)(=O)CC2)nc[nH]1 |
| InChI | InChI=1S/C9H13N3O3S/c13-9-5-8(10-6-11-9)12-7-1-3-16(14,15)4-2-7/h5-7H,1-4H2,(H2,10,11,12,13) |
| InChIKey | BZNZOEYPGMMGMX-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one (CID 136956144) is 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one is O=c1cc(NC2CCS(=O)(=O)CC2)nc[nH]1.
What is the InChIKey of 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one?
The InChIKey is BZNZOEYPGMMGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c13-9-5-8(10-6-11-9)12-7-1-3-16(14,15)4-2-7/h5-7H,1-4H2,(H2,10,11,12,13).
What are the key properties of 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one?
4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one has a molecular weight of 243.29 g/mol, XLogP of -0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxothian-4-yl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136956144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).