C11H14F3IN4O — CID 136956170
5-iodo-4-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]-1H-pyrimidin-6-one (PubChem CID 136956170) has the molecular formula C11H14F3IN4O and a molecular weight of 402.16 g/mol. Its IUPAC name is 5-iodo-4-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956170 |
| Molecular Formula | C11H14F3IN4O |
| Molecular Weight | 402.16 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 5-iodo-4-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC2CCN(CC(F)(F)F)C2)c1I |
| InChI | InChI=1S/C11H14F3IN4O/c12-11(13,14)5-19-2-1-7(4-19)3-16-9-8(15)10(20)18-6-17-9/h6-7H,1-5H2,(H2,16,17,18,20) |
| InChIKey | NVHLSRRNKCJHSC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|