About 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide
3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide (PubChem CID 136956194) has the molecular formula C9H13IN4O2
and a molecular weight of 336.13 g/mol. Its IUPAC name is 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
| PubChem CID | 136956194 |
| Molecular Formula | C9H13IN4O2 |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H13IN4O2/c1-14(2)6(15)3-4-11-8-7(10)9(16)13-5-12-8/h5H,3-4H2,1-2H3,(H2,11,12,13,16) |
| InChIKey | DCTJBJFADGFBDW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide?
The IUPAC name of 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide (CID 136956194) is 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide is CN(C)C(=O)CCNc1nc[nH]c(=O)c1I.
What is the InChIKey of 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide?
The InChIKey is DCTJBJFADGFBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13IN4O2/c1-14(2)6(15)3-4-11-8-7(10)9(16)13-5-12-8/h5H,3-4H2,1-2H3,(H2,11,12,13,16).
What are the key properties of 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide?
3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide has a molecular weight of 336.13 g/mol, XLogP of 0.26, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 136956194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).