C14H23BrN4O — CID 136956210
5-bromo-4-[3-[cyclohexyl(methyl)amino]propylamino]-1H-pyrimidin-6-one (PubChem CID 136956210) has the molecular formula C14H23BrN4O and a molecular weight of 343.27 g/mol. Its IUPAC name is 5-bromo-4-[3-[cyclohexyl(methyl)amino]propylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[3-[cyclohexyl(methyl)amino]propylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956210 |
| Molecular Formula | C14H23BrN4O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5-bromo-4-[3-[cyclohexyl(methyl)amino]propylamino]-1H-pyrimidin-6-one |
| SMILES | CN(CCCNc1nc[nH]c(=O)c1Br)C1CCCCC1 |
| InChI | InChI=1S/C14H23BrN4O/c1-19(11-6-3-2-4-7-11)9-5-8-16-13-12(15)14(20)18-10-17-13/h10-11H,2-9H2,1H3,(H2,16,17,18,20) |
| InChIKey | OUYMKGYRCHEYOT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|