C9H12BrN3O3 — CID 136956242
5-bromo-4-(1,4-dioxan-2-ylmethylamino)-1H-pyrimidin-6-one (PubChem CID 136956242) has the molecular formula C9H12BrN3O3 and a molecular weight of 290.12 g/mol. Its IUPAC name is 5-bromo-4-(1,4-dioxan-2-ylmethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(1,4-dioxan-2-ylmethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956242 |
| Molecular Formula | C9H12BrN3O3 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 5-bromo-4-(1,4-dioxan-2-ylmethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC2COCCO2)c1Br |
| InChI | InChI=1S/C9H12BrN3O3/c10-7-8(12-5-13-9(7)14)11-3-6-4-15-1-2-16-6/h5-6H,1-4H2,(H2,11,12,13,14) |
| InChIKey | VGYPZUJUVNUHFH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |