C12H17IN4O — CID 136956464
4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136956464) has the molecular formula C12H17IN4O and a molecular weight of 360.20 g/mol. Its IUPAC name is 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956464 |
| Molecular Formula | C12H17IN4O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2CCN3CCCCC23)c1I |
| InChI | InChI=1S/C12H17IN4O/c13-10-11(14-7-15-12(10)18)16-8-4-6-17-5-2-1-3-9(8)17/h7-9H,1-6H2,(H2,14,15,16,18) |
| InChIKey | QEVOXCDHTDWKLB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|