C8H12IN3O3 — CID 136956547
4-[2-(2-hydroxyethoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136956547) has the molecular formula C8H12IN3O3 and a molecular weight of 325.11 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956547 |
| Molecular Formula | C8H12IN3O3 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCOCCO)c1I |
| InChI | InChI=1S/C8H12IN3O3/c9-6-7(11-5-12-8(6)14)10-1-3-15-4-2-13/h5,13H,1-4H2,(H2,10,11,12,14) |
| InChIKey | IOOIEPIBWRRDTD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|