C10H17N3O2 — CID 136956777
4-(1-methoxybutan-2-ylamino)-2-methyl-1H-pyrimidin-6-one (PubChem CID 136956777) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-(1-methoxybutan-2-ylamino)-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-(1-methoxybutan-2-ylamino)-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956777 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-(1-methoxybutan-2-ylamino)-2-methyl-1H-pyrimidin-6-one |
| SMILES | CCC(COC)Nc1cc(=O)[nH]c(C)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-4-8(6-15-3)13-9-5-10(14)12-7(2)11-9/h5,8H,4,6H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | LEVRHKNTMZLAOV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |