C12H19N3O — CID 136956826
4-[(3,5-dimethylcyclohexyl)amino]-1H-pyrimidin-6-one (PubChem CID 136956826) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-[(3,5-dimethylcyclohexyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[(3,5-dimethylcyclohexyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956826 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 4-[(3,5-dimethylcyclohexyl)amino]-1H-pyrimidin-6-one |
| SMILES | CC1CC(C)CC(Nc2cc(=O)[nH]cn2)C1 |
| InChI | InChI=1S/C12H19N3O/c1-8-3-9(2)5-10(4-8)15-11-6-12(16)14-7-13-11/h6-10H,3-5H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | VRFJXCOOJNTYQH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |