About 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one
4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one (PubChem CID 136956903) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136956903 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(O)(CO)CNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C8H13N3O3/c1-8(14,4-12)3-9-6-2-7(13)11-5-10-6/h2,5,12,14H,3-4H2,1H3,(H2,9,10,11,13) |
| InChIKey | FABZBKLDVGHLOS-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one (CID 136956903) is 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one is CC(O)(CO)CNc1cc(=O)[nH]cn1.
What is the InChIKey of 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one?
The InChIKey is FABZBKLDVGHLOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-8(14,4-12)3-9-6-2-7(13)11-5-10-6/h2,5,12,14H,3-4H2,1H3,(H2,9,10,11,13).
What are the key properties of 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one?
4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one has a molecular weight of 199.21 g/mol, XLogP of -1.07, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,3-dihydroxy-2-methylpropyl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136956903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).