C10H15N3O3 — CID 136956949
4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136956949) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956949 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 4-[(4-hydroxyoxan-4-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC2(O)CCOCC2)nc[nH]1 |
| InChI | InChI=1S/C10H15N3O3/c14-9-5-8(12-7-13-9)11-6-10(15)1-3-16-4-2-10/h5,7,15H,1-4,6H2,(H2,11,12,13,14) |
| InChIKey | CBYWLEJDQAXYRE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |