C8H10IN3O2 — CID 136956961
5-iodo-4-(oxolan-3-ylamino)-1H-pyrimidin-6-one (PubChem CID 136956961) has the molecular formula C8H10IN3O2 and a molecular weight of 307.09 g/mol. Its IUPAC name is 5-iodo-4-(oxolan-3-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(oxolan-3-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956961 |
| Molecular Formula | C8H10IN3O2 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 5-iodo-4-(oxolan-3-ylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2CCOC2)c1I |
| InChI | InChI=1S/C8H10IN3O2/c9-6-7(10-4-11-8(6)13)12-5-1-2-14-3-5/h4-5H,1-3H2,(H2,10,11,12,13) |
| InChIKey | KBPQHMAQHUUGJL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|