C11H17N3O2 — CID 136956988
2-methyl-4-[(2-methyloxolan-2-yl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136956988) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-methyl-4-[(2-methyloxolan-2-yl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(2-methyloxolan-2-yl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956988 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2-methyl-4-[(2-methyloxolan-2-yl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NCC2(C)CCCO2)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H17N3O2/c1-8-13-9(6-10(15)14-8)12-7-11(2)4-3-5-16-11/h6H,3-5,7H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | FBCKPSAMDURHNA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |