C7H9F2N3O — CID 136957012
4-(2,2-difluoroethylamino)-2-methyl-1H-pyrimidin-6-one (PubChem CID 136957012) has the molecular formula C7H9F2N3O and a molecular weight of 189.17 g/mol. Its IUPAC name is 4-(2,2-difluoroethylamino)-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2-difluoroethylamino)-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957012 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 4-(2,2-difluoroethylamino)-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(NCC(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H9F2N3O/c1-4-11-6(2-7(13)12-4)10-3-5(8)9/h2,5H,3H2,1H3,(H2,10,11,12,13) |
| InChIKey | MEFCYPUWWQEHLR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |