C6H6BrF2N3O — CID 136957013
5-bromo-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one (PubChem CID 136957013) has the molecular formula C6H6BrF2N3O and a molecular weight of 254.03 g/mol. Its IUPAC name is 5-bromo-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957013 |
| Molecular Formula | C6H6BrF2N3O |
| Molecular Weight | 254.03 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 5-bromo-4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(F)F)c1Br |
| InChI | InChI=1S/C6H6BrF2N3O/c7-4-5(10-1-3(8)9)11-2-12-6(4)13/h2-3H,1H2,(H2,10,11,12,13) |
| InChIKey | XCSSNZDHDMXCOF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.03 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |