About 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one
5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136957040) has the molecular formula C8H12BrN3O3
and a molecular weight of 278.11 g/mol. Its IUPAC name is 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136957040 |
| Molecular Formula | C8H12BrN3O3 |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(CO)(CO)Nc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C8H12BrN3O3/c1-8(2-13,3-14)12-6-5(9)7(15)11-4-10-6/h4,13-14H,2-3H2,1H3,(H2,10,11,12,15) |
| InChIKey | NFUULSHPQDHFPP-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one (CID 136957040) is 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one is CC(CO)(CO)Nc1nc[nH]c(=O)c1Br.
What is the InChIKey of 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one?
The InChIKey is NFUULSHPQDHFPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrN3O3/c1-8(2-13,3-14)12-6-5(9)7(15)11-4-10-6/h4,13-14H,2-3H2,1H3,(H2,10,11,12,15).
What are the key properties of 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one?
5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one has a molecular weight of 278.11 g/mol, XLogP of -0.31, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136957040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).