About 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea
3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 136957069) has the molecular formula C9H14BrN5O2
and a molecular weight of 304.15 g/mol. Its IUPAC name is 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
| PubChem CID | 136957069 |
| Molecular Formula | C9H14BrN5O2 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C9H14BrN5O2/c1-15(2)9(17)12-4-3-11-7-6(10)8(16)14-5-13-7/h5H,3-4H2,1-2H3,(H,12,17)(H2,11,13,14,16) |
| InChIKey | YIGLLUWRXLIXJU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
The IUPAC name of 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea (CID 136957069) is 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
The canonical SMILES for 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea is CN(C)C(=O)NCCNc1nc[nH]c(=O)c1Br.
What is the InChIKey of 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
The InChIKey is YIGLLUWRXLIXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrN5O2/c1-15(2)9(17)12-4-3-11-7-6(10)8(16)14-5-13-7/h5H,3-4H2,1-2H3,(H,12,17)(H2,11,13,14,16).
What are the key properties of 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea?
3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea has a molecular weight of 304.15 g/mol, XLogP of 0.22, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea is sourced from PubChem (CID 136957069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).