C9H14IN3O2 — CID 136957292
4-(1-hydroxypentan-3-ylamino)-5-iodo-1H-pyrimidin-6-one (PubChem CID 136957292) has the molecular formula C9H14IN3O2 and a molecular weight of 323.13 g/mol. Its IUPAC name is 4-(1-hydroxypentan-3-ylamino)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-(1-hydroxypentan-3-ylamino)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957292 |
| Molecular Formula | C9H14IN3O2 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-(1-hydroxypentan-3-ylamino)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC(CCO)Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C9H14IN3O2/c1-2-6(3-4-14)13-8-7(10)9(15)12-5-11-8/h5-6,14H,2-4H2,1H3,(H2,11,12,13,15) |
| InChIKey | IVXZOFZMNILJBS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|