About 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one
4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one (PubChem CID 136957519) has the molecular formula C8H11N3O3S
and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one |
| PubChem CID | 136957519 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(N2CCS(=O)(=O)CC2)nc[nH]1 |
| InChI | InChI=1S/C8H11N3O3S/c12-8-5-7(9-6-10-8)11-1-3-15(13,14)4-2-11/h5-6H,1-4H2,(H,9,10,12) |
| InChIKey | ZTHHIXCEMQOJNI-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one?
The IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one (CID 136957519) is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one is O=c1cc(N2CCS(=O)(=O)CC2)nc[nH]1.
What is the InChIKey of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one?
The InChIKey is ZTHHIXCEMQOJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3S/c12-8-5-7(9-6-10-8)11-1-3-15(13,14)4-2-11/h5-6H,1-4H2,(H,9,10,12).
What are the key properties of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one?
4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one has a molecular weight of 229.26 g/mol, XLogP of -1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 136957519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).