About 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one
4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136958115) has the molecular formula C7H8F2IN3O
and a molecular weight of 315.06 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
| PubChem CID | 136958115 |
| Molecular Formula | C7H8F2IN3O |
| Molecular Weight | 315.06 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CN(CC(F)F)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C7H8F2IN3O/c1-13(2-4(8)9)6-5(10)7(14)12-3-11-6/h3-4H,2H2,1H3,(H,11,12,14) |
| InChIKey | GROVCCHNFIDBSL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.06 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one?
The IUPAC name of 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one (CID 136958115) is 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one?
The canonical SMILES for 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one is CN(CC(F)F)c1nc[nH]c(=O)c1I.
What is the InChIKey of 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one?
The InChIKey is GROVCCHNFIDBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2IN3O/c1-13(2-4(8)9)6-5(10)7(14)12-3-11-6/h3-4H,2H2,1H3,(H,11,12,14).
What are the key properties of 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one?
4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one has a molecular weight of 315.06 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-difluoroethyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one is sourced from PubChem (CID 136958115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).