C7H9N3O3 — CID 136958370
3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid (PubChem CID 136958370) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid.
| Compound Name | 3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 136958370 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 3-[(6-oxo-1H-pyrimidin-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C7H9N3O3/c11-6-3-5(9-4-10-6)8-2-1-7(12)13/h3-4H,1-2H2,(H,12,13)(H2,8,9,10,11) |
| InChIKey | YSSPJKJZCDWCQK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |