C8H12N4O3 — CID 136958402
3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid (PubChem CID 136958402) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 136958402 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)Nc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C8H12N4O3/c1-4(2-5(13)14)12-7-6(9)8(15)11-3-10-7/h3-4H,2,9H2,1H3,(H,13,14)(H2,10,11,12,15) |
| InChIKey | IERKDLZGRWFNLA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |