C8H11N3O3 — CID 136958432
2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid (PubChem CID 136958432) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 136958432 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
| SMILES | CCC(Nc1cc(=O)[nH]cn1)C(=O)O |
| InChI | InChI=1S/C8H11N3O3/c1-2-5(8(13)14)11-6-3-7(12)10-4-9-6/h3-5H,2H2,1H3,(H,13,14)(H2,9,10,11,12) |
| InChIKey | LUPHXUJKRGFECH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |