C14H23N3O3 — CID 136958677
methyl 4-methyl-2-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]pentanoate (PubChem CID 136958677) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is methyl 4-methyl-2-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]pentanoate |
|---|---|
| PubChem CID | 136958677 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | methyl 4-methyl-2-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)Nc1cc(=O)[nH]c(C(C)C)n1 |
| InChI | InChI=1S/C14H23N3O3/c1-8(2)6-10(14(19)20-5)15-11-7-12(18)17-13(16-11)9(3)4/h7-10H,6H2,1-5H3,(H2,15,16,17,18) |
| InChIKey | SCYRXVRFQZIFTJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |