C10H14N4O3 — CID 136959032
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-cyclopropylpropanoic acid (PubChem CID 136959032) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-cyclopropylpropanoic acid.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 136959032 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-cyclopropylpropanoic acid |
| SMILES | CC(Nc1nc[nH]c(=O)c1N)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H14N4O3/c1-10(9(16)17,5-2-3-5)14-7-6(11)8(15)13-4-12-7/h4-5H,2-3,11H2,1H3,(H,16,17)(H2,12,13,14,15) |
| InChIKey | XRIJEWISKGJXSS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |