C12H15N3O4 — CID 136959134
4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholine-3-carboxylic acid (PubChem CID 136959134) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholine-3-carboxylic acid.
| Compound Name | 4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 136959134 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholine-3-carboxylic acid |
| SMILES | O=C(O)C1COCCN1c1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C12H15N3O4/c16-10-5-9(13-11(14-10)7-1-2-7)15-3-4-19-6-8(15)12(17)18/h5,7-8H,1-4,6H2,(H,17,18)(H,13,14,16) |
| InChIKey | XDTBWWDSFWXRBZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |