C21H20N2O3 — CID 136959449
(4S,5S)-N-ethyl-2-[2-hydroxy-4-(2-phenylethynyl)phenyl]-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 136959449) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (4S,5S)-N-ethyl-2-[2-hydroxy-4-(2-phenylethynyl)phenyl]-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-N-ethyl-2-[2-hydroxy-4-(2-phenylethynyl)phenyl]-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 136959449 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (4S,5S)-N-ethyl-2-[2-hydroxy-4-(2-phenylethynyl)phenyl]-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | CCNC(=O)[C@H]1N=C(c2ccc(C#Cc3ccccc3)cc2O)O[C@H]1C |
| InChI | InChI=1S/C21H20N2O3/c1-3-22-20(25)19-14(2)26-21(23-19)17-12-11-16(13-18(17)24)10-9-15-7-5-4-6-8-15/h4-8,11-14,19,24H,3H2,1-2H3,(H,22,25)/t14-,19-/m0/s1 |
| InChIKey | BTDCMWMWNOCMSI-LIRRHRJNSA-N |
| XLogP | 2.46 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|