About 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide
1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide (PubChem CID 136959642) has the molecular formula C5H6F2N4O
and a molecular weight of 176.13 g/mol. Its IUPAC name is 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide |
| PubChem CID | 136959642 |
| Molecular Formula | C5H6F2N4O |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide |
| SMILES | N/C(=N\O)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C5H6F2N4O/c6-5(7)11-2-1-3(9-11)4(8)10-12/h1-2,5,12H,(H2,8,10) |
| InChIKey | VVXLLFOGIJMCMY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide?
The IUPAC name of 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide (CID 136959642) is 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide.
What is the SMILES notation for 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide?
The canonical SMILES for 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide is N/C(=N\O)c1ccn(C(F)F)n1.
What is the InChIKey of 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide?
The InChIKey is VVXLLFOGIJMCMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2N4O/c6-5(7)11-2-1-3(9-11)4(8)10-12/h1-2,5,12H,(H2,8,10).
What are the key properties of 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide?
1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide has a molecular weight of 176.13 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-N'-hydroxypyrazole-3-carboximidamide is sourced from PubChem (CID 136959642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).